A5190612
3-Iodo-biphenyl , 96% , 20442-79-9
CAS NO.：20442-79-9
Empirical Formula: C12H9I
Molecular Weight: 280.1
MDL number: MFCD09032441
EINECS: 243-826-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB129.60 | In Stock |
|
| 250mg | RMB240.00 | In Stock |
|
| 50mg | RMB240.00 | In Stock |
|
| 5G | RMB388.80 | In Stock |
|
| 25g | RMB1194.40 | In Stock |
|
| 100g | RMB4697.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 26.5℃ |
| Boiling point: | 211.35°C (rough estimate) |
| Density | 1.6696 (rough estimate) |
| refractive index | 1.7600 (estimate) |
| storage temp. | 2-8°C(protect from light) |
| form | clear liquid |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C12H9I/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
| InChIKey | KAQUBIATNWQNRE-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=CC(I)=C1 |
| CAS DataBase Reference | 20442-79-9 |
| EPA Substance Registry System | 1,1'-Biphenyl, 3-iodo- (20442-79-9) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| HS Code | 2903.99.8001 |
