PRODUCT Properties
| Melting point: | 208-210 °C(Solv: methanol (67-56-1)) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in chloroform and methan |
| form | powder |
| color | Orange-red |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C20H19NO4.ClH/c1-23-18-5-4-12-8-16-14-10-19(24-2)17(22)9-13(14)6-7-21(16)11-15(12)20(18)25-3;/h4-5,8-11H,6-7H2,1-3H3;1H/p+1 |
| InChIKey | JKMUUZMCSNHBAX-UHFFFAOYSA-O |
| SMILES | C12=CC3=C(C(OC)=C(OC)C=C3)C=[N+]1CCC1C=C(O)C(OC)=CC2=1.Cl |
Description and Uses
Jaztorrhizine is an alkaloid extract from the Berberidaceae family of plants displaying antioxidant activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| HS Code | 29399990 |
