Kinetin , 99% , 525-79-1
Synonym(s):
6-Furfurylaminopurine;FAP;N6-Furfuryladenine;Seprase
CAS NO.:525-79-1
Empirical Formula: C10H9N5O
Molecular Weight: 215.21
MDL number: MFCD00075757
EINECS: 208-382-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB124.00 | In Stock |
|
| 100G | RMB431.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 269-271 °C (dec.)(lit.) |
| Boiling point: | 355.49°C (rough estimate) |
| Density | 1.2639 (rough estimate) |
| bulk density | 360kg/m3 |
| refractive index | 1.7610 (estimate) |
| Flash point: | 269-271°C |
| storage temp. | -70°C |
| solubility | H2O: soluble |
| pka | pKa1 2.7; pKa2 9.9(at 25℃) |
| form | crystalline |
| color | white |
| PH | 5.5-6.5 (20°C, 10g/L in H2O, filtered suspension) |
| Water Solubility | Soluble in water (<1 mg/ml) at 25°C, Acetic acid (49.00-51.00 mg/ml), DMSO (43 mg/ml) at 25°C, ethanol (<1 mg/ml) at 25°C, 0.1 N Sodium hydroxide (1% w/v), methanol (slightly), and dilute aqueous hydrochloric acid or sodium hydroxide (freely). |
| Decomposition | 269-271 ºC |
| Merck | 14,5311 |
| BRN | 21703 |
| Specific Activity | ≥1800units/μg protein |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C10H9N5O/c1-2-7(16-3-1)4-11-9-8-10(13-5-12-8)15-6-14-9/h1-3,5-6H,4H2,(H2,11,12,13,14,15) |
| InChIKey | QANMHLXAZMSUEX-UHFFFAOYSA-N |
| SMILES | C(Nc1ncnc2[nH]cnc12)c3ccco3 |
| LogP | 1.200 (est) |
| CAS DataBase Reference | 525-79-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Kinetin(525-79-1) |
| EPA Substance Registry System | Kinetin (525-79-1) |
Description and Uses
Kinetin (or Vivakin) was introduced as Kinerase in the US as a new ingredient for the treatment of age related photodamage of skin. This 6- furfurylaminopurine is a synthetic cytokinin, a family of plant growth factors, and was shown to be a highly potent growth factor. In vitro, it was able to delay or prevent the onset of age-related changes in skin cells without affecting cellular lifespan. In a double-blind clinical trial, Kinetin (0.005%) partially reversed the clinical signs of photodamaged skin and demonstrated a good safety profile. It could have potential in psoriasis as well as in other proliferative skin disorders.
A cell division factor found in various plant parts and in yeast. A plant growth regulator. Augments growth of microbial cultures
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 68-36/37/38 |
| Safety Statements | 23-24/25-22-36/37/39-27-26 |
| WGK Germany | 3 |
| RTECS | AU6270000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 525-79-1(Hazardous Substances Data) |
| Toxicity | LD50 intraperitoneal in mouse: 450mg/kg |



