A5250312
α-Lactose monohydrate , Super pure level, ≥99.5%(HPLC) , 5989-81-1
Synonym(s):
β-D -Gal-(1→4)-α-D -Glc;4-O-β-D -Galactopyranosyl-α-D -glucose;Milk sugar
CAS NO.:5989-81-1
Empirical Formula: C12H24O12
Molecular Weight: 360.31
MDL number: MFCD00150747
EINECS: 611-913-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB734.40 | In Stock |
|
| 100G | RMB1184.00 | In Stock |
|
| 500G | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 219 °C |
| Boiling point: | 412.35°C (rough estimate) |
| alpha | [α]D20+52.2~+52.8° |
| Density | 1,53 g/cm3 |
| RTECS | OD9625000 |
| refractive index | 1.6480 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: soluble1M, clear, colorless |
| form | Solid |
| color | White to Off-White |
| PH | pH (50g/l, 25℃) : 4.0~6.0 |
| biological source | bovine milk |
| Water Solubility | Soluble in water. |
| Stability: | Hygroscopic |
| InChI | 1S/C12H22O11.H2O/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17;/h3-20H,1-2H2;1H2/t3-,4-,5+,6+,7-,8-,9-,10-,11+,12+;/m1./s1 |
| InChIKey | WSVLPVUVIUVCRA-KPKNDVKVSA-N |
| SMILES | [H]O[H].OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O |
| CAS DataBase Reference | 5989-81-1(CAS DataBase Reference) |
| EPA Substance Registry System | .alpha.-D-Glucopyranose, 4-O-.beta.-D-galactopyranosyl-, hydrate (1:1) (5989-81-1) |
Description and Uses
alpha-D-Lactose monohydrate is used as a carrier and stabiliser of aromas, pharmaceutical products, Food industry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 40-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 17021100 |
| Storage Class | 11 - Combustible Solids |




