A5253512
Lactulose , ≥98% , 4618-18-2
Synonym(s):
4-O-β-D -Galactopyranosyl-D -fructofuranose;4-O-β-D -Galactopyranosyl-D -fructose;Lactulose
CAS NO.:4618-18-2
Empirical Formula: C12H22O11
Molecular Weight: 342.3
MDL number: MFCD00151469
EINECS: 225-027-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB30.40 | In Stock |
|
| 5G | RMB92.00 | In Stock |
|
| 25G | RMB342.40 | In Stock |
|
| 100G | RMB1235.20 | In Stock |
|
| 500g | RMB4319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~169 °C (dec.) |
| Boiling point: | 397.76°C (rough estimate) |
| alpha | -47 º (C=5, H2O, 12HR) |
| Density | 1,32g/cm |
| refractive index | 1,45-1,47 |
| storage temp. | Refrigerator |
| solubility | Freely soluble in water, sparingly soluble in methanol, practically insoluble in toluene. |
| pka | 11.67±0.20(Predicted) |
| form | Powder |
| color | White to almost white |
| optical activity | [α]20/D 48±2°, 24 hr, c = 1% in H2O |
| Water Solubility | 76.4 G/100 ML (30 ºC) |
| Merck | 5346 |
| BRN | 93773 |
| BCS Class | 2 |
| Cosmetics Ingredients Functions | HUMECTANT SKIN CONDITIONING |
| Cosmetic Ingredient Review (CIR) | Lactulose (4618-18-2) |
| InChI | 1S/C12H22O11/c13-1-4-6(16)7(17)8(18)11(21-4)22-9-5(2-14)23-12(20,3-15)10(9)19/h4-11,13-20H,1-3H2/t4-,5-,6+,7+,8-,9-,10+,11+,12+/m1/s1 |
| InChIKey | PFCRQPBOOFTZGQ-VZXVHDRGSA-N |
| SMILES | OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@](O)(CO)[C@H]2O)[C@H](O)[C@@H](O)[C@H]1O |
| LogP | -2.885 (est) |
| CAS DataBase Reference | 4618-18-2(CAS DataBase Reference) |
| EPA Substance Registry System | D-Fructose, 4-O-.beta.-D-galactopyranosyl- (4618-18-2) |
| CAS Number Unlabeled | 4618-18-2 |
Description and Uses
A keto analogue of lactose.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 2 |
| RTECS | LS6965000 |
| TSCA | TSCA listed |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |



