A5284112
Leu-Leu , 98% , 3303-31-9
CAS NO.:3303-31-9
Empirical Formula: C12H24N2O3
Molecular Weight: 244.33
MDL number: MFCD00065185
EINECS: 221-976-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB156.80 | In Stock |
|
| 5G | RMB543.20 | In Stock |
|
| 10g | RMB1030.40 | In Stock |
|
| 25g | RMB2238.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270-272℃ (decomposition) |
| Boiling point: | 432.7±30.0 °C(Predicted) |
| Density | 1.051±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | Methanol (Slightly, Heated), Water (Slightly, Sonicated) |
| form | Solid |
| pka | 3.16±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C12H24N2O3/c1-7(2)5-9(13)11(15)14-10(12(16)17)6-8(3)4/h7-10H,5-6,13H2,1-4H3,(H,14,15)(H,16,17)/t9-,10-/m0/s1 |
| InChIKey | LCPYQJIKPJDLLB-UWVGGRQHSA-N |
| SMILES | C(O)(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)N |
Description and Uses
Leu-Leu-OH (L-Leucyl-L-leucine), a Leu derivative, is a neutral dipeptide that can be used to study the functionality of dileucine motifs[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |






