A5284812
Lead phthalocyanine , 95% , 15187-16-3
Synonym(s):
Phthalocyanine lead salt
| Pack Size | Price | Stock | Quantity |
| 1G | RMB287.20 | In Stock |
|
| 5G | RMB1079.20 | In Stock |
|
| 25g | RMB2392.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.39 g/cm3 |
| form | powder to crystal |
| color | Dark red to Dark purple to Dark blue |
| λmax | 698 nm |
| InChIKey | WSQYJDCCFQPFJC-UHFFFAOYSA-N |
| SMILES | [PbH2]1n2c3nc4nc(nc5n1c(nc6nc(nc2c7ccccc37)c8ccccc68)c9ccccc59)c%10ccccc4%10 |
| CAS DataBase Reference | 15187-16-3 |
| EPA Substance Registry System | Lead, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- (15187-16-3) |
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302+H332-H360D-H373-H410 |
| Precautionary statements | P201-P273-P301+P312+P330-P304+P340+P312-P308+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,N |
| Risk Statements | 61-20/22-33-50/53-62 |
| Safety Statements | 53-45-60-61 |
| RIDADR | UN 2291 6.1/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Repr. 1A STOT RE 2 |









