A5287912
Lonafarnib , 95% , 193275-84-2
Synonym(s):
4-[2-[4-[(11R)-3,10-Dibromo-8-chloro-6,11-dihydro-5Hbenzo[5,6]cyclohepta[1,2-b]pyridin-11-yl]-1-piperidinyl]-2-oxoethyl]-1-piperidinecarboxamide;SCH66336;SCH-66336
| Pack Size | Price | Stock | Quantity |
| 1MG | RMB231.20 | In Stock |
|
| 5MG | RMB799.20 | In Stock |
|
| 10MG | RMB1359.20 | In Stock |
|
| 25mg | RMB3063.20 | In Stock |
|
| 50MG | RMB5519.20 | In Stock |
|
| 100mg | RMB9431.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 214.5-215.9° (monohydrate); mp 222-223° |
| alpha | D25 = +49.1° (c = 0.21 in methanol) |
| Boiling point: | 710.4±70.0 °C(Predicted) |
| Density | 1.536 |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder |
| pka | 15.76±0.40(Predicted) |
| color | white to beige |
| InChIKey | DHMTURDWPRKSOA-RUZDIDTESA-N |
| SMILES | O=C(N)N(CC1)CCC1CC(N2CCC([C@H]3C(N=CC(Br)=C4)=C4CCC5=C3C(Br)=CC(Cl)=C5)CC2)=O |
Description and Uses
Lonafarnib is an orally bioavailable tricyclic inhibitor of farnesyl protein transferase. It inhibits Rheb farnesylation and mTOR signaling and enhances taxane and tamoxifen antitumor activity. Studies show that it induces CCAAT/enhancer-binding protein homologous protein-dependent expression of death receptor 5, leading to induction of apoptosis in human cancer cells
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







