A5304412
Levothyroxine sodium hydrate , Analysis standard , 25416-65-3
Synonym(s):
L -Thyroxin monosodium salt hydrate;3,3′,5,5′-Tetraiodo-L-thyronine monosodium salt hydrate;Sodium O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-L -tyrosine hydrate
CAS NO.:25416-65-3
Empirical Formula: C15H10I4NNaO4
Molecular Weight: 798.85
MDL number: MFCD06408007
EINECS: 685-634-1
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB556.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 207 °C |
| alpha | 16 º (c=2,1M HCl/alcohol 1/4) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Very slightly soluble in water, slightly soluble in ethanol (96 per cent). It dissolves in dilute solutions of alkali hydroxides. |
| form | Liquid |
| color | Clear yellow to yellow-greenish |
| Water Solubility | 0.15 g/L (25 ºC) |
| Stability: | Hygroscopic |
| Major Application | agriculture environmental |
| InChI | InChI=1/C15H11I4NO4.Na/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23;/h1-2,4-5,12,21H,3,20H2,(H,22,23);/q;+1/p-1/t12-;/s3 |
| InChIKey | YDTFRJLNMPSCFM-ZLBVLXFENA-M |
| SMILES | C1(=CC(=C(O)C(I)=C1)I)OC1=C(I)C=C(C[C@H](N)C([O-])=O)C=C1I.[Na+] |&1:16,r| |
| CAS DataBase Reference | 25416-65-3(CAS DataBase Reference) |
Description and Uses
Thyroid hormone replacement.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H372 |
| Precautionary statements | P260-P264-P270-P314-P501 |
| target organs | Thyroid,Cardio-vascular system,Kidney |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29379000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | STOT RE 1 |







