A5305212
Lapachol , 98% , 84-79-7
Synonym(s):
2-Hydroxy-3-(3-methyl-2-butenyl)-1,4-naphthoquinone;Natural Yellow 16
CAS NO.:84-79-7
Empirical Formula: C15H14O3
Molecular Weight: 242.27
MDL number: MFCD00001679
EINECS: 201-563-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB551.20 | In Stock |
|
| 1g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 141-143 °C(lit.) |
| Boiling point: | 325.09°C (rough estimate) |
| Density | 1.2077 (rough estimate) |
| refractive index | 1.5740 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | ethanol: soluble10mg/mL, clear, light yellow to yellow |
| pka | 4.81±0.10(Predicted) |
| form | Solid |
| Colour Index | 75490 |
| color | Yellow to Dark Yellow |
| Merck | 13,5382 |
| Cosmetics Ingredients Functions | SKIN PROTECTING ANTIOXIDANT |
| InChI | InChI=1S/C15H14O3/c1-9(2)7-8-12-13(16)10-5-3-4-6-11(10)14(17)15(12)18/h3-7,18H,8H2,1-2H3 |
| InChIKey | CIEYTVIYYGTCCI-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)C(C/C=C(/C)\C)=C1O |
| LogP | 2.516 (est) |
| CAS DataBase Reference | 84-79-7 |
Description and Uses
Lapachol, a benzoquinone, is a secondary allergen in teak (Tectona grandis).
antineoplastic, antifungal
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | QL8750000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 in male, female BALB/c mice (g/kg): 0.487; 0.792 orally (Morrison) |






