A5311912
Loxoprofen , >97.0%(HPLC) , 68767-14-6
Synonym(s):
α-Methyl-4-[(2-oxocyclopentyl)methyl]benzeneacetic acid;Koloxo
CAS NO.:68767-14-6
Empirical Formula: C15H18O3
Molecular Weight: 246.31
MDL number: MFCD00864331
EINECS: 1806241-263-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB46.40 | In Stock |
|
| 25g | RMB148.00 | In Stock |
|
| 100g | RMB453.60 | In Stock |
|
| 500g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108.5-111° |
| Boiling point: | bp0.3 190-195° |
| Density | 1.182±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | solid |
| pka | 4.39±0.10(Predicted) |
| color | White to Off-White |
| Merck | 14,5589 |
| InChI | InChI=1S/C15H18O3/c1-10(15(17)18)12-7-5-11(6-8-12)9-13-3-2-4-14(13)16/h5-8,10,13H,2-4,9H2,1H3,(H,17,18) |
| InChIKey | YMBXTVYHTMGZDW-UHFFFAOYSA-N |
| SMILES | C(C1CCCC1=O)C1C=CC(C(C)C(=O)O)=CC=1 |
| CAS DataBase Reference | 68767-14-6(CAS DataBase Reference) |
Description and Uses
antiinflammatory, analgesic
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2918.99.3000 |
| Storage Class | 11 - Combustible Solids |



![2-[(4-Acetylphenyl)methyl]cyclopentan-1-one](https://img.chemicalbook.com/CAS/20180703/GIF/96824-28-1.gif)


