A5347712
1-methyl-1H-indazole-3-carboxylic acid , 99% , 50890-83-0
Synonym(s):
1-Methylindazole-3-carboxylic acid;Granisetron Hydrochloride Impurity D
CAS NO.:50890-83-0
Empirical Formula: C9H8N2O2
Molecular Weight: 176.17
MDL number: MFCD00272569
EINECS: 626-233-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB52.00 | In Stock |
|
| 5G | RMB179.20 | In Stock |
|
| 25G | RMB752.80 | In Stock |
|
| 100g | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 213 °C |
| Boiling point: | 383.7±15.0 °C(Predicted) |
| Density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.14±0.10(Predicted) |
| form | Solid |
| color | White to Off White |
| Water Solubility | Insoluble in water. Soluble in DMSO and Methanol. |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C9H8N2O2/c1-11-7-5-3-2-4-6(7)8(10-11)9(12)13/h2-5H,1H3,(H,12,13) |
| InChIKey | OVVDFORZEGKEJM-UHFFFAOYSA-N |
| SMILES | N1(C)C2=C(C=CC=C2)C(C(O)=O)=N1 |
| CAS DataBase Reference | 50890-83-0(CAS DataBase Reference) |
Description and Uses
Granisetron Impurity D.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P301+P312+P330-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36-36/37/38 |
| Safety Statements | 26-36/37/39-22 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |







![N-[(1R,3r,5S)-9-azabicyclo[3.3.1]non-3-yl]-1-Methyl-1H-indazole-3-carboxaMide hydrochloride](https://img.chemicalbook.com/CAS/GIF/141136-01-8.gif)