A5348512
5-Methoxypsoralen , Analysis of standard products,> 98.0% , 484-20-8
Synonym(s):
Bergapten;5-Methoxypsoralen;Majudin;Geralen;Heraclin
CAS NO.:484-20-8
Empirical Formula: C12H8O4
Molecular Weight: 216.19
MDL number: MFCD00010272
EINECS: 207-604-5
| Pack Size | Price | Stock | Quantity |
| 20MG | RMB193.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190-193 °C(lit.) |
| Boiling point: | 276.6°C (rough estimate) |
| Density | 1.1344 (rough estimate) |
| refractive index | 1.4270 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Pale Yellow |
| Merck | 14,1157 |
| BRN | 19560 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. May be light sensitive. |
| InChI | 1S/C12H8O4/c1-14-12-7-2-3-11(13)16-10(7)6-9-8(12)4-5-15-9/h2-6H,1H3 |
| InChIKey | BGEBZHIAGXMEMV-UHFFFAOYSA-N |
| SMILES | COc1c2C=CC(=O)Oc2cc3occc13 |
| LogP | 2.035 (est) |
| CAS DataBase Reference | 484-20-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 7H-furo[3,2-g][1]benzopyran-7-one, 4-methoxy-(484-20-8) |
| IARC | 2A (Vol. 40, Sup 7) 1987 |
| EPA Substance Registry System | 5-Methoxypsoralen (484-20-8) |
Description and Uses
Bergapten exists in roots, stems, and leaves of a variety of Rutaceae, Umbelliferae, and leguminous plants such as ephedra, fennel, and vetch.
Has been used to promote tanning in suntan preparations.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H317-H341-H351 |
| Precautionary statements | P202-P261-P272-P280-P302+P352-P308+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | Xi,T |
| Risk Statements | 43-45 |
| Safety Statements | 36/37-45-53 |
| WGK Germany | 2 |
| RTECS | LV1300000 |
| F | 8-10 |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 Muta. 2 Skin Sens. 1 |
| Hazardous Substances Data | 484-20-8(Hazardous Substances Data) |






