A5350112
2-Mercapto-5-methyl-1,3,4-thiadiazole , 99% , 29490-19-5
Synonym(s):
2-Mercapto-5-methyl-1,3,4-thiadiazole
CAS NO.:29490-19-5
Empirical Formula: C3H4N2S2
Molecular Weight: 132.21
MDL number: MFCD00038349
EINECS: 249-667-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB44.00 | In Stock |
|
| 50g | RMB56.00 | In Stock |
|
| 100G | RMB114.40 | In Stock |
|
| 250g | RMB239.20 | In Stock |
|
| 500G | RMB408.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185-188 °C |
| Boiling point: | 182.9±23.0 °C(Predicted) |
| Density | 1.373 (estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | chloroform: soluble10mg/mL, clear to very slightly hazy, colorless |
| pka | 6.49±0.40(Predicted) |
| form | solid |
| color | White to Off-White |
| Water Solubility | 2 g/100 mL |
| BRN | 606663 |
| InChI | InChI=1S/C3H4N2S2/c1-2-4-5-3(6)7-2/h1H3,(H,5,6) |
| InChIKey | FPVUWZFFEGYCGB-UHFFFAOYSA-N |
| SMILES | S1C(C)=NNC1=S |
| CAS DataBase Reference | 29490-19-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3,4-Thiadiazole-2(3H)-thione, 5-methyl-(29490-19-5) |
Description and Uses
5-Methyl-1,3,4-thiadiazol-2-thiol (Cefazolin EP Impurity E), is a new potent nitrification inhibitors. It is also an intermediate in the synthesis of Thiazolylacetylglycine Oxime (T344230).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29349990 |





![7-Amino-3-[(5-methyl-1,3,4-thiadiazol-2-ylthio)methyl]-3-cephem-4-carboxylicAcid](https://img.chemicalbook.com/CAS/GIF/30246-33-4.gif)
![(6R,7R)-3-(((5-methyl-1,3,4-thiadiazol-2-yl)thio)methyl)-8-oxo-7-pivalamido-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid](https://img.chemicalbook.com/CAS/20180703/GIF/CB43159611.gif)
![(6R-trans)-3-(acetoxymethyl)-8-oxo-7-(1H-tetrazol-1-ylacetamido)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/32510-61-5.gif)