A5351012
1-Methyl-3-octylimidazolium chloride , ≥97.0%(HPLC) , 64697-40-1
Synonym(s):
OMIMCl
| Pack Size | Price | Stock | Quantity |
| 5G | RMB38.40 | In Stock |
|
| 25G | RMB147.20 | In Stock |
|
| 50g | RMB287.20 | In Stock |
|
| 100G | RMB558.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 12°C(lit.) |
| Density | 1.01 g/mL at 20 °C(lit.) |
| refractive index | n |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Yellow |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C12H23N2.ClH/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;/h10-12H,3-9H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | OXFBEEDAZHXDHB-UHFFFAOYSA-M |
| SMILES | [Cl-].CCCCCCCC[n+]1ccn(C)c1 |
Description and Uses
Role of 1-methyl-3-octylimidazolium chloride in the micellization behavior of amphiphilic drug amitriptyline hydrochloride.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
