A5352112
Methyl 2-(Aminosulfonyl)benzoate , 98% , 57683-71-3
CAS NO.：57683-71-3
Empirical Formula: C8H9NO4S
Molecular Weight: 215.23
MDL number: MFCD00009808
EINECS: 260-903-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB28.80 | In Stock |
|
| 25G | RMB44.00 | In Stock |
|
| 100G | RMB112.80 | In Stock |
|
| 500G | RMB358.40 | In Stock |
|
| 2.5kg | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-128 °C (lit.) |
| Boiling point: | 401.4±47.0 °C(Predicted) |
| Density | 1.377±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 9.65±0.60(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C8H9NO4S/c1-13-8(10)6-4-2-3-5-7(6)14(9,11)12/h2-5H,1H3,(H2,9,11,12) |
| InChIKey | VSOOBQALJVLTBH-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC=C1S(N)(=O)=O |
| CAS DataBase Reference | 57683-71-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Methyl 2-(aminosulfonyl)benzoate(57683-71-3) |
| EPA Substance Registry System | Benzoic acid, 2-(aminosulfonyl)-, methyl ester (57683-71-3) |
Description and Uses
Methyl 2-(aminosulfonyl)benzoate was used in the preparation of pyrazol-benzenesulfonamides, 2-(1-phenyl-1H-pyrazol-5-yl)benzenesulfonamides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | DH6830000 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29350090 |
