A5352812
Mucobromic Acid , 99% , 488-11-9
Synonym(s):
2,3-Dibromomalealdehydic acid
CAS NO.：488-11-9
Empirical Formula: C4H2Br2O3
Molecular Weight: 257.86
MDL number: MFCD00063745
EINECS: 207-670-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB71.20 | In Stock |
|
| 25G | RMB94.40 | In Stock |
|
| 100G | RMB249.60 | In Stock |
|
| 500G | RMB854.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-124 °C (lit.) |
| Boiling point: | 321.8±42.0 °C(Predicted) |
| Density | 2.2801 (rough estimate) |
| refractive index | 1.4947 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | methanol: 0.1 g/mL, clear |
| pka | 0.28±0.44(Predicted) |
| form | Crystalline Powder |
| color | White to beige |
| BRN | 1705707 |
| InChI | InChI=1S/C4H2Br2O3/c5-2(1-7)3(6)4(8)9/h1H,(H,8,9)/b3-2- |
| InChIKey | NCNYEGJDGNOYJX-IHWYPQMZSA-N |
| SMILES | C(O)(=O)/C(/Br)=C(/Br)\C=O |
| CAS DataBase Reference | 488-11-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Mucobromic acid(488-11-9) |
| EPA Substance Registry System | 2-Butenoic acid, 2,3-dibromo-4-oxo-, (2Z)- (488-11-9) |
Description and Uses
Mucobromic Acid is an inhibitor of tumoral and pancreatic L-asparagine synthetases.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C,Xi |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29183000 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
