A5357412
α-Methylcinnamic acid , 99% , 1199-77-5
Synonym(s):
alpha-Methylcinnamic acid
CAS NO.:1199-77-5
Empirical Formula: C10H10O2
Molecular Weight: 162.19
MDL number: MFCD00002652
EINECS: 214-847-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB38.40 | In Stock |
|
| 100G | RMB75.20 | In Stock |
|
| 250g | RMB175.20 | In Stock |
|
| 500G | RMB343.20 | In Stock |
|
| 2.5kg | RMB1679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 79-81 °C(lit.) |
| Boiling point: | 288 °C |
| Density | 1.0281 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.82±0.10(Predicted) |
| form | Crystals or Crystalline Powder |
| color | White to yellow |
| BRN | 2042544 |
| InChI | InChI=1S/C10H10O2/c1-8(10(11)12)7-9-5-3-2-4-6-9/h2-7H,1H3,(H,11,12) |
| InChIKey | XNCRUNXWPDJHGV-BQYQJAHWSA-N |
| SMILES | C(O)(=O)C(C)=CC1=CC=CC=C1 |
| LogP | 2.600 |
| CAS DataBase Reference | 1199-77-5(CAS DataBase Reference) |
| NIST Chemistry Reference | «ALPHA»-methylcinnamic acid(1199-77-5) |
Description and Uses
Alpha-methylcinnamic acid
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |







