A5357612
4-Methoxy-2-methylphenylboronic acid , 97% , 208399-66-0
Synonym(s):
2-Methyl-4-methoxybenzeneboronic acid;2-Methyl-4-methoxyphenylboronic acid;4-Methoxy-2-methylbenzeneboronic acid
CAS NO.:208399-66-0
Empirical Formula: C8H11BO3
Molecular Weight: 165.98
MDL number: MFCD02684315
EINECS: 681-537-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB64.00 | In Stock |
|
| 5G | RMB217.60 | In Stock |
|
| 25g | RMB679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 169-174 °C (lit.) |
| Boiling point: | 327.1±52.0 °C(Predicted) |
| Density | 1.14±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 9.03±0.58(Predicted) |
| form | Crystalline Solid |
| color | White |
| Water Solubility | Insoluble in water. |
| BRN | 8111222 |
| InChI | InChI=1S/C8H11BO3/c1-6-5-7(12-2)3-4-8(6)9(10)11/h3-5,10-11H,1-2H3 |
| InChIKey | AMSQNQJCBXQYEX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(OC)C=C1C)(O)O |
| CAS DataBase Reference | 208399-66-0(CAS DataBase Reference) |
Description and Uses
Reactant for preparation of biologically active molecule preparation of hydroxyphenylnaphthols as 17?-hydroxysteroid dehydrogenase Type 2 inhibitors
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |







