PRODUCT Properties
| Melting point: | 27-29 °C(lit.) |
| Boiling point: | 273-275 °C(lit.) |
| Density | 0.937 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 142 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| Specific Gravity | 0.937 |
| color | Clear colorless to amber |
| Odor | at 1.00 % in dipropylene glycol. musty anisic |
| Odor Type | musty |
| BRN | 907733 |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | InChI=1S/C10H12O2/c1-3-10(11)8-4-6-9(12-2)7-5-8/h4-7H,3H2,1-2H3 |
| InChIKey | ZJVAWPKTWVFKHG-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(OC)C=C1)(=O)CC |
| LogP | 2.359 (est) |
| CAS DataBase Reference | 121-97-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Propanone, 1-(4-methoxyphenyl)-(121-97-1) |
| EPA Substance Registry System | 1-Propanone, 1-(4-methoxyphenyl)- (121-97-1) |
Description and Uses
4''-Methoxypropiophenone is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H228-H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a-P210-P240-P241-P280 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29145090 |
| Storage Class | 10 - Combustible liquids |






