A5358812
Methyl coumalate , 98% , 6018-41-3
Synonym(s):
Methyl 2-oxo-2H-pyran-5-carboxylate;Methyl 2-pyrone-5-carboxylate
CAS NO.:6018-41-3
Empirical Formula: C7H6O4
Molecular Weight: 154.12
MDL number: MFCD00010120
EINECS: 227-871-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB65.60 | In Stock |
|
| 5G | RMB196.00 | In Stock |
|
| 25G | RMB541.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-67 °C (lit.) |
| Boiling point: | 178-180 °C/60 mmHg (lit.) |
| Density | 1.1993 (rough estimate) |
| refractive index | 1.4300 (estimate) |
| Flash point: | 178-180°C/60mm |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Freely soluble in dichloromethane. |
| form | powder to crystal |
| color | White to Orange to Green |
| Merck | 14,2557 |
| BRN | 126301 |
| InChI | InChI=1S/C7H6O4/c1-10-7(9)5-2-3-6(8)11-4-5/h2-4H,1H3 |
| InChIKey | HHWWWZQYHPFCBY-UHFFFAOYSA-N |
| SMILES | C1(=O)OC=C(C(OC)=O)C=C1 |
| LogP | -0.660 (est) |
| CAS DataBase Reference | 6018-41-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2H-Pyran-5-carboxylic acid, 2-oxo-, methyl ester(6018-41-3) |
Description and Uses
α, β-Unsaturated ketone Methyl Coumalate showed cytotoxicity against human normal gingival fibroblast cells and oral squamous cell carcinoma cell line-2.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H317-H334-H351b |
| Precautionary statements | P201-P202-P261-P272-P280g-P302+P352-P308+P313-P363-P403-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2932209090 |
| Storage Class | 11 - Combustible Solids |




