A5359612
3-Methoxy-2-nitropyridine , 98% , 20265-37-6
CAS NO.：20265-37-6
Empirical Formula: C6H6N2O3
Molecular Weight: 154.12
MDL number: MFCD00222276
EINECS: 606-480-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB32.80 | In Stock |
|
| 25G | RMB97.60 | In Stock |
|
| 100G | RMB314.40 | In Stock |
|
| 500g | RMB1639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-76 °C (lit.) |
| Boiling point: | 311.8±22.0 °C(Predicted) |
| Density | 1.300±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | -6.34±0.10(Predicted) |
| color | White to Yellow to Green |
| InChI | InChI=1S/C6H6N2O3/c1-11-5-3-2-4-7-6(5)8(9)10/h2-4H,1H3 |
| InChIKey | QRCUQLANPHYVEH-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=NC=CC=C1OC |
| CAS DataBase Reference | 20265-37-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
