A5360312
Methyl 2-amino-3,5-dibromobenzoate , 98% , 606-00-8
CAS NO.:606-00-8
Empirical Formula: C8H7Br2NO2
Molecular Weight: 308.95
MDL number: MFCD00010873
EINECS: 400-990-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB89.60 | In Stock |
|
| 100G | RMB335.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 89-91 °C(lit.) |
| Boiling point: | 317.9±37.0 °C(Predicted) |
| Density | 1.907±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | -0.30±0.10(Predicted) |
| Appearance | White to off-white Solid |
| BRN | 3257505 |
| InChI | InChI=1S/C8H7Br2NO2/c1-13-8(12)5-2-4(9)3-6(10)7(5)11/h2-3H,11H2,1H3 |
| InChIKey | NGXVMFCGYYHEGC-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC(Br)=CC(Br)=C1N |
| CAS DataBase Reference | 606-00-8(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2-amino-3,5-dibromo-, methyl ester (606-00-8) |
Description and Uses
Methyl 2-amino-3,5-dibromobenzoate can be used in the synthesis of drug hexyl bromide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29224999 |





