A5361312
4-Methoxydiphenylamine , 98% , 1208-86-2
CAS NO.：1208-86-2
Empirical Formula: C13H13NO
Molecular Weight: 199.25
MDL number: MFCD00228649
EINECS: 214-902-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB164.00 | In Stock |
|
| 10g | RMB324.80 | In Stock |
|
| 25G | RMB780.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104.0 to 108.0 °C |
| Boiling point: | 195°C/12mmHg(lit.) |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Very Slightly) |
| form | Solid |
| pka | 1.47±0.20(Predicted) |
| color | White |
| InChI | InChI=1S/C13H13NO/c1-15-13-9-7-12(8-10-13)14-11-5-3-2-4-6-11/h2-10,14H,1H3 |
| InChIKey | OBHGSIGHEBGGFS-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=CC=C2)=CC=C(OC)C=C1 |
| CAS DataBase Reference | 1208-86-2 |
Description and Uses
4-Methoxy-N-phenylaniline is a metabolite found from pears and apples.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| HS Code | 29222990 |
