A5362312
3-Amino-2-methoxypyridine , 98% , 20265-38-7
CAS NO.:20265-38-7
Empirical Formula: C6H8N2O
Molecular Weight: 124.14
MDL number: MFCD00833386
EINECS: 673-107-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB103.20 | In Stock |
|
| 25G | RMB318.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67 °C |
| Boiling point: | 118°C/13mmHg(lit.) |
| Density | 1.139±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.33±0.10(Predicted) |
| color | Orange to Brown to Dark red |
| InChI | InChI=1S/C6H8N2O/c1-9-6-5(7)3-2-4-8-6/h2-4H,7H2,1H3 |
| InChIKey | YXFAOWYMDGUFIQ-UHFFFAOYSA-N |
| SMILES | C1(OC)=NC=CC=C1N |
| CAS DataBase Reference | 20265-38-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-41-37/38-22 |
| Safety Statements | 26-36/37/39-39 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |




