A5364912
Methyl 4-hydroxybenzoate sodium salt , 99% , 5026-62-0
Synonym(s):
4-Hydroxybenzoic acid methyl ester sodium salt, Methylparaben sodium salt;Methyl 4-hydroxybenzoate sodium salt;Methylis parahydroxybenzoas natricum;Sodium methyl 4-hydroxybenzoate
CAS NO.:5026-62-0
Empirical Formula: C8H7NaO3
Molecular Weight: 174.13
MDL number: MFCD00016470
EINECS: 225-714-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB25.60 | In Stock |
|
| 25G | RMB47.20 | In Stock |
|
| 100G | RMB77.60 | In Stock |
|
| 500G | RMB252.00 | In Stock |
|
| 2.5KG | RMB1024.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >125°C |
| Density | 1.42 g/cm3 (20 °C) |
| storage temp. | Store at +15°C to +25°C. |
| solubility | Freely soluble in water, sparingly soluble in ethanol (96 per cent), practically insoluble in methylene chloride. |
| pka | 8.4[at 20 ℃] |
| form | Powder |
| color | White |
| PH | 9.7-10.3 (1g/l, H2O) |
| Water Solubility | 418g/L at 20℃ |
| BRN | 4165000 |
| Cosmetics Ingredients Functions | PRESERVATIVE |
| InChI | InChI=1S/C8H8O3.Na.H/c1-11-8(10)6-2-4-7(9)5-3-6;;/h2-5,9H,1H3;; |
| InChIKey | PESXGULMKCKJCC-UHFFFAOYSA-M |
| SMILES | C(C1C=CC(O)=CC=1)(=O)OC.[NaH] |
| LogP | -0.63 at 20℃ |
| CAS DataBase Reference | 5026-62-0(CAS DataBase Reference) |
| EPA Substance Registry System | Methylparaben sodium (5026-62-0) |
Description and Uses
Methyl 4-hydroxybenzoate has antimicrobial characteristics and is used as preservative in pharmaceutical formulations and cosmetics. It can be combined with other parabens like propyl 4-hydroxybenzoate or ethyl 4-hydroxybenzoate. The sodium salt provides improved solubility in water compared to standard methyl 4-hydroxybenzoate.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H315-H318-H412 |
| Precautionary statements | P273-P280-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-24/25 |
| WGK Germany | 1 |
| RTECS | DH2455000 |
| Autoignition Temperature | >600 °C |
| HS Code | 29182930 |
| Toxicity | LD50 orally in Rabbit: > 5000 mg/kg |




