A5366812
3-(Methylthio)-1-hexanol , 98% , 51755-66-9
CAS NO.：51755-66-9
Empirical Formula: C7H16OS
Molecular Weight: 148.27
MDL number: MFCD00010674
EINECS: 257-380-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB84.80 | In Stock |
|
| 25G | RMB271.20 | In Stock |
|
| 100G | RMB1028.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 61-62 °C10 mm Hg(lit.) |
| Density | 0.966 g/mL at 25 °C(lit.) |
| FEMA | 3438 | 3-(METHYLTHIO)-1-HEXANOL |
| refractive index | n |
| Flash point: | 226 °F |
| pka | 14.90±0.10(Predicted) |
| Odor | at 0.10 % in propylene glycol. sulfurous metallic green leafy vegetable |
| Odor Type | sulfurous |
| biological source | synthetic |
| JECFA Number | 463 |
| Major Application | flavors and fragrances |
| InChI | InChI=1S/C7H16OS/c1-3-4-7(9-2)5-6-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | JSASXSHMJYRPCM-UHFFFAOYSA-N |
| SMILES | C(O)CC(SC)CCC |
| LogP | 1.81 |
| CAS DataBase Reference | 51755-66-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Methylthio-1-hexanol(51755-66-9) |
Description and Uses
3-(Methylthio)-l-hexanol has a green, vegetable odor.
3-(Methylthio)-1-hexanol may be used in chemical synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | UN 3334 |
| WGK Germany | 3 |
| HazardClass | 9 |
| HS Code | 29309099 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 STOT SE 3 |
