A5378012
Malonyl dichloride , 97% , 1663-67-8
Synonym(s):
Malonyl dichloride
CAS NO.:1663-67-8
Empirical Formula: C3H2Cl2O2
Molecular Weight: 140.95
MDL number: MFCD00000735
EINECS: 216-772-9
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 53-55 °C/19 mmHg (lit.) |
| Density | 1.449 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 117 °F |
| storage temp. | 2-8°C |
| solubility | sol most organic solvents |
| pka | 6.86±0.46(Predicted) |
| form | Liquid |
| color | Clear yellow to orange to brown |
| Water Solubility | decomposes |
| BRN | 774044 |
| InChI | InChI=1S/C3H2Cl2O2/c4-2(6)1-3(5)7/h1H2 |
| InChIKey | SXYFKXOFMCIXQW-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)CC(Cl)=O |
| CAS DataBase Reference | 1663-67-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Malonyl dichloride(1663-67-8) |
| EPA Substance Registry System | Propanedioyl dichloride (1663-67-8) |
Description and Uses
Malonyl chloride can be used as a reactant for the synthesis of:
- Alkaloids with tetracyclic cores such as cyclopiamide A and speradine E.
- 6-tetrathiafulvalene(TTF)-polymer by condensation polymerization with TTF-based dihydroxy monomer.
- N-doped TiO2 films by molecular layer deposition.
- Alkyne-substituted 1,3-oxazines by reaction with arylpropynamides.
It can also be used as a coupling agent in the synthesis of block copolymers by anionic polymerization.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P210-P233-P303+P361+P353-P370+P378-P403+P235-P501 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 14-34-29-10 |
| Safety Statements | 26-36/37/39-45-16 |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | - |
| F | 8-10 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29171990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 Skin Corr. 1B |




