A5384412
Methyl 3-Methoxyacrylate , 95% , 34846-90-7
CAS NO.:34846-90-7
Empirical Formula: C5H8O3
Molecular Weight: 116.12
MDL number: MFCD00128206
EINECS: 672-629-4
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB31.20 | In Stock |
|
| 25ML | RMB113.60 | In Stock |
|
| 100ML | RMB308.00 | In Stock |
|
| 500ML | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 3-4°C |
| Boiling point: | 56 °C18 mm Hg(lit.) |
| Density | 1.08 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 145 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| Water Solubility | Soluble in water |
| form | Liquid |
| color | Clear colorless |
| InChI | InChI=1S/C5H8O3/c1-7-4-3-5(6)8-2/h3-4H,1-2H3 |
| InChIKey | AUTCCPQKLPMHDN-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C=COC |
| CAS DataBase Reference | 34846-90-7(CAS DataBase Reference) |
Description and Uses
Methyl trans-3-methoxyacrylate is a natural β-methoxyacrylate which inhibits mitochondrial respiration and exhibits fungicidal activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313-P403+P235 |
| Hazard Codes | Xi |
| Risk Statements | 43-36/37/38 |
| Safety Statements | 24-37-37/39-26 |
| RIDADR | 3334 |
| WGK Germany | 1 |
| HS Code | 29189900 |




