A5390912
Mosher’s acid , 99% , 20445-31-2
Synonym(s):
(+)-MTPA;Mosher’s acid
CAS NO.:20445-31-2
Empirical Formula: C10H9F3O3
Molecular Weight: 234.17
MDL number: MFCD00004184
EINECS: 243-829-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB333.60 | In Stock |
|
| 1G | RMB697.60 | In Stock |
|
| 5g | RMB2790.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46-49 °C(lit.) |
| Boiling point: | 105-107 °C1 mm Hg(lit.) |
| alpha | D25 +68.5 ± 1.3° (c = 1.49 in CH3OH) |
| Density | 1.344 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Soluble in methanol (50 mg/ 1 ml). |
| form | Crystalline Low Melting Solid |
| pka | 1.47±0.10(Predicted) |
| color | White |
| Specific Gravity | 1.344 |
| optical activity | [α]20/D +73±1°, c = 2% in methanol |
| Sensitive | Hygroscopic |
| Merck | 14,6280 |
| BRN | 2215440 |
| InChI | 1S/C10H9F3O3/c1-16-9(8(14)15,10(11,12)13)7-5-3-2-4-6-7/h2-6H,1H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | JJYKJUXBWFATTE-SECBINFHSA-N |
| SMILES | CO[C@@](C(O)=O)(c1ccccc1)C(F)(F)F |
| CAS DataBase Reference | 20445-31-2(CAS DataBase Reference) |
Description and Uses
(R)-(+)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic acid is widely used reagent for determination of optical purities of alcohols and amines by 1H or 19F NMR.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT, HYGROSCOPIC, KEEP COLD |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





