A5391612
4,4'-Difluorobenzophenone , 99% , 345-92-6
CAS NO.:345-92-6
Empirical Formula: C13H8F2O
Molecular Weight: 218.2
MDL number: MFCD00000353
EINECS: 206-466-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB30.40 | In Stock |
|
| 100G | RMB108.80 | In Stock |
|
| 500G | RMB400.00 | In Stock |
|
| 2.5kg | RMB1671.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 102-105 °C (lit.) |
| Boiling point: | 137°C (3 torr) |
| Density | 1.2543 (estimate) |
| vapor pressure | 0.005Pa at 20℃ |
| Flash point: | 170-172°C/10mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Insoluble in water |
| form | Crystalline Powder |
| color | White to slightly yellow |
| Water Solubility | 8.757mg/L at 20℃ |
| BRN | 516231 |
| InChI | 1S/C13H8F2O/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8H |
| InChIKey | LSQARZALBDFYQZ-UHFFFAOYSA-N |
| SMILES | Fc1ccc(cc1)C(=O)c2ccc(F)cc2 |
| LogP | 3.37 at 20℃ |
| CAS DataBase Reference | 345-92-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 4,4'-Difluorobenzophenone(345-92-6) |
| EPA Substance Registry System | 4,4'-Difluorobenzophenone (345-92-6) |
Description and Uses
4,4′-Difluorobenzophenone has been used in the study of thermal stability, water uptake and proton conductivity of carboxylated, carboxylated/sulfonated, and crosslinked membranes.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H411 |
| Precautionary statements | P273-P301+P312+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-51/53-22 |
| Safety Statements | 26-37/39-36-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| RTECS | DJ0685000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29143990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







