A5392812
5-Mercapto-1-methyltetrazole , 98% , 13183-79-4
CAS NO.:13183-79-4
Empirical Formula: C2H4N4S
Molecular Weight: 116.14
MDL number: MFCD00037317
EINECS: 236-132-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 25G | RMB68.80 | In Stock |
|
| 100G | RMB206.40 | In Stock |
|
| 500G | RMB628.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-128 °C (lit.) |
| Boiling point: | 111.6±23.0 °C(Predicted) |
| Density | 1.420 (estimate) |
| refractive index | 1.5605 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly), Water (Slightly) |
| form | solid |
| pka | 0.70±0.20(Predicted) |
| color | White to Off-White |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C2H4N4S/c1-6-2(7)3-4-5-6/h1H3,(H,3,5,7) |
| InChIKey | XOHZHMUQBFJTNH-UHFFFAOYSA-N |
| SMILES | N1(C)C(=S)N=NN1 |
| CAS DataBase Reference | 13183-79-4(CAS DataBase Reference) |
| EPA Substance Registry System | 5H-Tetrazole-5-thione, 1,2-dihydro-1-methyl- (13183-79-4) |
Description and Uses
N-Methyl-5-tetrazolethiol (Cefoperazone EP Impurity C) is an impurity of Cefoperazone.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| RIDADR | transport forbidden |
| WGK Germany | 3 |
| RTECS | XF7600000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29339900 |
| Storage Class | 4.1A - Other explosive hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![[6R-[6alpha,7beta(R*)]]-3-(acetoxymethyl)-7-[(formyloxy)phenylacetamido]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/87932-78-3.gif)
