A5393612
N-Methyl-N-(trimethylsilyl)trifluoroacetamide , Used for GC derivation, ≥98.5%(GC) , 24589-78-4
Synonym(s):
N-Methyl-N-(trimethylsilyl)trifluoroacetamide;N-Trimethylsilyl-N-methyl trifluoroacetamide;2,2,2-Trifluoro-N-methyl-N-(trimethylsilyl)acetamide;MSTFA;N-Methyl-N-trimethylsilyl-trifluoroacetamide
CAS NO.:24589-78-4
Empirical Formula: C6H12F3NOSi
Molecular Weight: 199.25
MDL number: MFCD00000411
EINECS: 246-331-6
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB253.60 | In Stock |
|
| 5ML | RMB639.20 | In Stock |
|
| 10×1ml | RMB952.00 | In Stock |
|
| 25ML | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-100°C |
| Boiling point: | 130132°C |
| Density | 1.075 g/mL at 25 °C(lit.) |
| vapor density | >1 (vs air) |
| vapor pressure | 8.8 mm Hg ( 27 °C) |
| refractive index | n |
| Flash point: | 77 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| pka | -1.34±0.70(Predicted) |
| color | Clear colorless to light yellow |
| Specific Gravity | 1.076 |
| Water Solubility | reacts |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 1941550 |
| Major Application | forensics and toxicology |
| InChI | 1S/C6H12F3NOSi/c1-10(12(2,3)4)5(11)6(7,8)9/h1-4H3 |
| InChIKey | MSPCIZMDDUQPGJ-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C(F)(F)F)[Si](C)(C)C |
| CAS DataBase Reference | 24589-78-4(CAS DataBase Reference) |
| EPA Substance Registry System | Acetamide, 2,2,2-trifluoro-N-methyl-N-(trimethylsilyl)- (24589-78-4) |
Description and Uses
A new metabolite of Famprofazone in humans.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,F,T,N |
| Risk Statements | 10-36/37/38-61-50/53-51/53 |
| Safety Statements | 26-36-37/39-16-45-53-61 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| RTECS | AC9800000 |
| F | 10-21 |
| Hazard Note | Flammable |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





