A5395012
5-Methyl-2-pyrazinecarboxylic acid , 98% , 5521-55-1
CAS NO.:5521-55-1
Empirical Formula: C6H6N2O2
Molecular Weight: 138.12
MDL number: MFCD00068241
EINECS: 413-260-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5G | RMB51.20 | In Stock |
|
| 25G | RMB104.80 | In Stock |
|
| 100G | RMB249.60 | In Stock |
|
| 500g | RMB1061.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-171 °C(lit.) |
| Boiling point: | 253.51°C (rough estimate) |
| Density | 1.3471 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.53±0.10(Predicted) |
| form | Amorphous Powder |
| color | Orange |
| BRN | 116005 |
| InChI | InChI=1S/C6H6N2O2/c1-4-2-8-5(3-7-4)6(9)10/h2-3H,1H3,(H,9,10) |
| InChIKey | RBYJWCRKFLGNDB-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NC=C(C)N=C1 |
| LogP | -0.254 (est) |
| CAS DataBase Reference | 5521-55-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Methylpyrazine-5-carboxylic acid(5521-55-1) |
Description and Uses
5-Methyl-2-pyrazinecarboxylic acid may be used in the preparation of novel europium(III) complexes, (5-methyl-2-pyrazinecarboxylato) (phenanthroline)europium(III). It may be used in the synthesis of Ln-metal organic frameworks (MOFs).
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 41-36/37/38 |
| Safety Statements | 26-39-36 |
| WGK Germany | 1 |
| Hazard Note | Irritant |
| HS Code | 29339990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 |





