A5395612
MBTH hydrochloride hydrate , 98% , 149022-15-1
Synonym(s):
3-Methyl-2-benzothiazolinone-hydrazonehydrochloride;MBTH
CAS NO.:149022-15-1
Empirical Formula: C8H10ClN3S
Molecular Weight: 215.7
MDL number: MFCD00005816
EINECS: 677-687-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB50.40 | In Stock |
|
| 5G | RMB124.80 | In Stock |
|
| 25G | RMB372.80 | In Stock |
|
| 100G | RMB1148.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 276-278 °C (dec.)(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated), Water (Slightly, Sonicated) |
| form | Solid |
| color | White to Light Gray |
| Water Solubility | Soluble in water, dimethyl sulfoxide and methanol. |
| BRN | 3571041 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C8H9N3S.CH4.ClH/c1-11-6-4-2-3-5-7(6)12-8(11)10-9;;/h2-5H,9H2,1H3;1H4;1H/b10-8+;; |
| InChIKey | RYPTUXJWIGSNFE-PIHABLKOSA-N |
| SMILES | CN1/C(/SC2C=CC=CC1=2)=N\N.Cl.C |
Description and Uses
3-Methyl-2-benzothiazolinone hydrazone hydrochloride hydrate (MBTH hydrochloride hydrate) was used as an electrophilic coupling reagent for the determination of residual chlorine.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H319 |
| Precautionary statements | P264-P270-P280-P301+P310-P305+P351+P338-P337+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xi |
| Risk Statements | 25-36-36/37/38 |
| Safety Statements | 26-36-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DL7160200 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29342000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |




![3-(Piperidin-4-yl)benzo[d]isoxazolehydrochloride](https://img.chemicalbook.com/CAS/GIF/84163-22-4.gif)
