A5399956
2,2-Dimethyl-6,6,7,7,8,8,8-heptafluoro-3,5-octanedione , 97% , 17587-22-3
Synonym(s):
2,2-Dimethyl-6,6,7,7,8,8,8-heptafluoro-3,5-octanedione
CAS NO.:17587-22-3
Empirical Formula: C10H11F7O2
Molecular Weight: 296.18
MDL number: MFCD00000435
EINECS: 241-556-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB319.20 | In Stock |
|
| 25g | RMB1519.20 | In Stock |
|
| 100g | RMB4959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38 °C |
| Boiling point: | 46-47 °C/5 mmHg (lit.) |
| Density | 1.273 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 101 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | liquid |
| pka | 6.74±0.46(Predicted) |
| Specific Gravity | 1.273 |
| color | colorless to pale yellow |
| BRN | 2056991 |
| Stability: | Stable. Flammable. Incompatible with oxidizing agents, combustible material. |
| InChI | 1S/C10H11F7O2/c1-7(2,3)5(18)4-6(19)8(11,12)9(13,14)10(15,16)17/h4H2,1-3H3 |
| InChIKey | SQNZLBOJCWQLGQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 17587-22-3(CAS DataBase Reference) |
| EPA Substance Registry System | 3,5-Octanedione, 6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl- (17587-22-3) |
Description and Uses
6,6,7,7,8,8,8-Heptafluoro-2,2-dimethyl-3,5-octanedione (2,2-Dimethyl-6,6,7,7,8,8,8-heptafluoro-3,5-octanedione) was used as a co-inducer in the production of human γ interferon (HuIFN-γ). It was also used as a beta-diketone chelating agent in the extraction of supercritical carbon dioxide.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H226 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P280-P303+P361+P353-P403+P235-P501-P280g-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 10-37 |
| Safety Statements | 23-24/25 |
| RIDADR | UN 1224 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |








