A5403212
4-Methylumbelliferyl-2-acetamido-2-deoxy-β-D-glucopyranoside , 98% , 37067-30-4
Synonym(s):
4-Methylumbelliferyl-2-acetamido-2-deoxy-β-D -glucopyranoside;4-Methylumbelliferyl-2-acetamido-2-deoxy-β-D -gluco-pyrano-side;4-Methylumbelliferyl-2-acetamido-2-deoxy-β-D-glucopyranoside;4-Methylumbelliferyl-N-acetyl-β-D-glucosaminide - CAS 37067-30-4 - Calbiochem
CAS NO.:37067-30-4
Empirical Formula: C18H21NO8
Molecular Weight: 379.37
MDL number: MFCD00065481
EINECS: 253-333-0
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB116.80 | In Stock |
|
| 250MG | RMB340.00 | In Stock |
|
| 1G | RMB909.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208-210 °C |
| Boiling point: | 507.24°C (rough estimate) |
| Density | 1.4163 (rough estimate) |
| refractive index | 1.5740 (estimate) |
| storage temp. | -20°C |
| solubility | DMF: 20 mg/mL, clear, colorless |
| pka | 12.87±0.70(Predicted) |
| form | Crystalline solid |
| color | White to Off-White |
| λmax | 360nm(Phosphate buffer sol.)(lit.) |
| BRN | 1693397 |
| Stability: | Light Sensitive - Protect from Light |
| InChIKey | PAVCYMSNMRWMAK-DMYIEBNJSA-N |
| SMILES | [H]O[H].[H]O[H].CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1Oc2ccc3C(C)=CC(=O)Oc3c2 |
| LogP | 0.340 (est) |
| CAS DataBase Reference | 37067-30-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2H-1-Benzopyran-2-one, 7-[[2-(acetylamino)-2-deoxy-.beta.-D-glucopyranosyl]oxy]-4-methyl- (37067-30-4) |
Description and Uses
4-METHYLUMBELLIFERYL-N-ACETYL-BETA-D-GLUCOSAMINIDE is used for the assay of b-Acetylglucosaminidase. A fluorogenic substrate used for the diagnosis of GM2 gangliosidoses in leukocytes. Genetic defects in human b-hexosaminidase isozy mes (Hex A & Hex B) result in various clinical and biochemical types of GM2 gangliosidosis. They include Tay Sachs disease, Sandhoff disease and other forms. Fluorescence: max. Abs. l = 325nm, max. Em. l = 378nm
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS02 |
| Signal word | Danger |
| Hazard statements | H314-H226 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P264-P280-P370+P378-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P403+P235-P405 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29321900 |
| Storage Class | 11 - Combustible Solids |








