A5433412
1-Methyl-L-histidine , 98% , 332-80-9
Synonym(s):
Nτ-Methyl-L -histidine;3-(1-Methylimidazol-4-yl)-L -alanine;3-Methyl-L -histidine (archaic)
CAS NO.：332-80-9
Empirical Formula: C7H11N3O2
Molecular Weight: 169.18
MDL number: MFCD00005295
EINECS: 206-368-0
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB559.20 | In Stock |
|
| 250MG | RMB1895.20 | In Stock |
|
| 1G | RMB7199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~240 °C (dec.) (lit.) |
| Boiling point: | 298.47°C (rough estimate) |
| alpha | -24 º (c=2% in H2O) |
| Density | 1.2509 (rough estimate) |
| refractive index | 1.5950 (estimate) |
| storage temp. | 2-8°C(protect from light) |
| solubility | Methanol (Slightly), Water (Slightly, Sonicated) |
| pka | 1.69(at 25℃) |
| form | Solid |
| color | Off-White to Pale Beige |
| optical activity | [α]20/D 24±1°, c = 2% in H2O |
| BRN | 9727 |
| Stability: | Hygroscopic |
| Major Application | peptide synthesis |
| InChI | 1S/C7H11N3O2/c1-10-3-5(9-4-10)2-6(8)7(11)12/h3-4,6H,2,8H2,1H3,(H,11,12)/t6-/m0/s1 |
| InChIKey | BRMWTNUJHUMWMS-LURJTMIESA-N |
| SMILES | Cn1cnc(C[C@H](N)C(O)=O)c1 |
| CAS DataBase Reference | 332-80-9(CAS DataBase Reference) |
Description and Uses
The urinary 1- and 3-methylhistidine (1- and 3-MH) metabolites as potential biomarkers of skeletal muscle toxicity. These metabolites were highly correlated to sex-, dose-, and time-dependent development of cerivastatin-induced myotoxicity. Natural but non-proteinogenic amino acid; employed as index of muscle protein breakdown.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25-22 |
| WGK Germany | 3 |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
