A5436412
(S)-(+)-α-Methoxy-α-trifluoromethylphenylacetyl chloride , >98.0%(GC) , 20445-33-4
Synonym(s):
(S)-(+)-MTPA-Cl;Mosher’s acid chloride
CAS NO.:20445-33-4
Empirical Formula: C10H8ClF3O2
Molecular Weight: 252.62
MDL number: MFCD00067105
EINECS: 633-847-5
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB228.80 | In Stock |
|
| 250MG | RMB863.20 | In Stock |
|
| 1G | RMB2607.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 213-214 °C(lit.) |
| alpha | D24 +129.0± 0.2° (c = 5.17 in CCl4) |
| Density | 1.35 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 194 °F |
| storage temp. | -20°C |
| form | Liquid |
| color | Clear colorless to light yellow |
| Specific Gravity | 1.353 |
| optical activity | [α]20/D +137±2°, c = 6.4% in carbon tetrachloride |
| Water Solubility | Slightly miscible with water. |
| Sensitive | Moisture Sensitive |
| Merck | 14,6280 |
| BRN | 3591564 |
| InChI | 1S/C10H8ClF3O2/c1-16-9(8(11)15,10(12,13)14)7-5-3-2-4-6-7/h2-6H,1H3/t9-/m1/s1 |
| InChIKey | PAORVUMOXXAMPL-SECBINFHSA-N |
| SMILES | CO[C@@](C(Cl)=O)(c1ccccc1)C(F)(F)F |
| CAS DataBase Reference | 20445-33-4(CAS DataBase Reference) |
Description and Uses
Used in the synthesis of natural products and pheromones.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34-43 |
| Safety Statements | 26-36/37/39-45-27 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Corrosive/Freeze |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29189900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |







