A5436512
(S)-(-)-α-Methoxy-α-(trifluoromethyl)phenylacetic acid , 98% , 17257-71-5
Synonym(s):
(−)-MTPA;Mosher’s acid
CAS NO.:17257-71-5
Empirical Formula: C10H9F3O3
Molecular Weight: 234.17
MDL number: MFCD00064200
EINECS: 241-292-1
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB399.20 | In Stock |
|
| 1G | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46-49 °C(lit.) |
| alpha | D24 -71.8± 0.6° (c = 3.28 in CH3OH) |
| Boiling point: | 95-97 °C0.05 mm Hg(lit.) |
| Density | 1.303 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Readily soluble in hexane, ether, THF, CH2Cl2, benzene. |
| form | Viscous Liquid or Low Melting Solid |
| pka | 1.47±0.10(Predicted) |
| color | Clear colorless or white |
| Specific Gravity | 1.303 |
| optical activity | [α]20/D 73±1°, c = 2% in methanol |
| Sensitive | Hygroscopic |
| Merck | 14,6280 |
| BRN | 3591561 |
| InChI | 1S/C10H9F3O3/c1-16-9(8(14)15,10(11,12)13)7-5-3-2-4-6-7/h2-6H,1H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | JJYKJUXBWFATTE-VIFPVBQESA-N |
| SMILES | CO[C@](C(O)=O)(c1ccccc1)C(F)(F)F |
| CAS DataBase Reference | 17257-71-5(CAS DataBase Reference) |
Description and Uses
(S)-(-)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic acid is used as a chiral derivatizing agent, it reacts with an alcohol or amine of unknown stereochemistry to form an ester or amide. The absolute configuration of the ester or amide is then determined by proton and/or 19F NMR spectroscopy.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 3-10 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT, HYGROSCOPIC, KEEP COLD |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






