A5436812
3-Methoxybenzylamine , 98% , 5071-96-5
CAS NO.:5071-96-5
Empirical Formula: C8H11NO
Molecular Weight: 137.18
MDL number: MFCD00008115
EINECS: 225-779-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB34.40 | In Stock |
|
| 25G | RMB220.00 | In Stock |
|
| 100G | RMB529.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 140 °C/37 mmHg (lit.) |
| Density | 1.072 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 9.03±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.0720 |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Air Sensitive |
| BRN | 1447182 |
| InChI | InChI=1S/C8H11NO/c1-10-8-4-2-3-7(5-8)6-9/h2-5H,6,9H2,1H3 |
| InChIKey | GRRIMVWABNHKBX-UHFFFAOYSA-N |
| SMILES | C1(CN)=CC=CC(OC)=C1 |
| CAS DataBase Reference | 5071-96-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Methoxybenzylamine(5071-96-5) |
Description and Uses
3-Methoxybenzylamine was used in the preparation of 6-substituted purines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,C,Xn |
| Risk Statements | 36/37/38-20/21/22-22 |
| Safety Statements | 26-36-45-36/37/39 |
| RIDADR | UN 2735 8/PG 3 |
| WGK Germany | 3 |
| RTECS | DP5550000 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29222990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







