A5438912
4-Methyl-3-nitrobenzonitrile , 98% , 939-79-7
Synonym(s):
3-Nitro-p-tolunitrile
| Pack Size | Price | Stock | Quantity |
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB135.20 | In Stock |
|
| 100G | RMB472.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 102-106 °C (lit.) |
| Boiling point: | 171°C 12mm |
| Density | 1.26±0.1 g/cm3(Predicted) |
| Flash point: | 171°C/12mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Chloroform, Ethyl Acetate |
| form | Crystalline Powder |
| color | White to yellow to pale brown |
| BRN | 2047311 |
| InChI | 1S/C8H6N2O2/c1-6-2-3-7(5-9)4-8(6)10(11)12/h2-4H,1H3 |
| InChIKey | KOFBNBCOGKLUOM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1[N+]([O-])=O)C#N |
| CAS DataBase Reference | 939-79-7(CAS DataBase Reference) |
Description and Uses
4-Methyl-3-nitrobenzonitrile may be used in the synthesis of (E)-1-(4-cyano-2-nitrophenyl)-2-(4-(4-cyanophenoxy)phenyl)ethene and (E)-1-(4-fluorophenyl)-2-(4-cyano-2-nitrophenyl)ethene.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




