A5440312
2-Methyl-3-(trifluoromethyl)aniline , 99% , 54396-44-0
Synonym(s):
2-Amino-6-(trifluoromethyl)toluene;2-Methyl-3-(trifluoromethyl)aniline;Flunixin Meglumine Impurity B (Ph. Eur.)
CAS NO.:54396-44-0
Empirical Formula: C8H8F3N
Molecular Weight: 175.15
MDL number: MFCD00153216
EINECS: 259-145-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB28.80 | In Stock |
|
| 25g | RMB124.00 | In Stock |
|
| 100g | RMB466.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-42 °C(lit.) |
| Boiling point: | 62-64°C 4mm |
| Density | 1.237±0.06 g/cm3(Predicted) |
| Flash point: | >210 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 3.23±0.10(Predicted) |
| form | Crystalline Powder |
| color | White |
| BRN | 2832865 |
| InChI | InChI=1S/C8H8F3N/c1-5-6(8(9,10)11)3-2-4-7(5)12/h2-4H,12H2,1H3 |
| InChIKey | TWLDBACVSHADLI-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(C(F)(F)F)=C1C |
| CAS DataBase Reference | 54396-44-0(CAS DataBase Reference) |
Description and Uses
2-Methyl-3-trifluoromethylaniline is a reactant in the synthesis of methylguanidine derivatives as prospective PET radioligands for the open channel of the NMDA receptor, linked to Alzheimer’s, epilepsy and other neurodegenerative disorders.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,T,T+ |
| Risk Statements | 36/37/38-26/27/28 |
| Safety Statements | 26-36-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT |
| HazardClass | 6.1 |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |




