Metribuzin , Analysis standard , 21087-64-9
CAS NO.:21087-64-9
Empirical Formula: C8H14N4OS
Molecular Weight: 214.29
MDL number: MFCD00055525
EINECS: 244-209-7
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB174.40 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 125°C |
| Boiling point: | 132 °C(Press: 0.02 Torr) |
| Density | 1.28 |
| refractive index | 1.6390 (estimate) |
| Flash point: | 2 °C |
| storage temp. | APPROX 4°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | -0.16±0.20(Predicted) |
| form | Solid |
| color | White |
| Odor | mild odor |
| Water Solubility | Slightly soluble |
| BRN | 746650 |
| Exposure limits | NIOSH REL: 5 mg/m3; ACGIH TLV: TWA 5 mg/m3. |
| InChI | 1S/C8H14N4OS/c1-8(2,3)5-6(13)12(9)7(14-4)11-10-5/h9H2,1-4H3 |
| InChIKey | FOXFZRUHNHCZPX-UHFFFAOYSA-N |
| SMILES | CSC1=NN=C(C(=O)N1N)C(C)(C)C |
| NIST Chemistry Reference | Metribuzin(21087-64-9) |
| EPA Substance Registry System | Metribuzin (21087-64-9) |
Description and Uses
Metribuzin is a colorless crystalline solid witha mild sulfurous odor; Freezing/Melting point =125- -127*C; Vapor pressure=4X 10-7 mmHg. SlightlyDescription: Metribuzin is a colorless crystalline solid witha mild sulfurous odor; Freezing/Melting point =125- -127*C; Vapor pressure=4X 10-7 mmHg. Slightlysoluble in water. Available in different concentrations (4%,50%, 75%).50%, 75%).
Selective herbicide used for preemergence broad-leaved weed control in potatoes, tomatoes, lucerne, raspberry and sugarcane, and postemergence weed control in beets. Also used for selective control of annual grasses.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P264-P270-P273-P301+P312+P330-P391-P501 |
| Hazard Codes | Xn;N,N,Xn,F |
| Risk Statements | 22-50/53-36-20/21/22-11 |
| Safety Statements | 2-60-61-36-26-16-36/37 |
| RIDADR | UN3077 9/PG 3 |
| OEB | B |
| OEL | TWA: 5 mg/m3 |
| WGK Germany | 3 |
| RTECS | XZ2990000 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29336990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 21087-64-9(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 2200 mg/kg; LC50 in rainbow trout: >10 ppm (Loeser, Kimmerle) |








