A5446012
3-Methoxyphenylacetic Acid , 99% , 1798-09-0
CAS NO.:1798-09-0
Empirical Formula: C9H10O3
Molecular Weight: 166.17
MDL number: MFCD00004334
EINECS: 217-282-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB95.20 | In Stock |
|
| 25G | RMB319.20 | In Stock |
|
| 100G | RMB799.20 | In Stock |
|
| 500g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-69 °C (lit.) |
| Boiling point: | 306 °C |
| Density | 1.1708 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform and Ethyl Acetate. |
| pka | 4.19±0.10(Predicted) |
| form | Flakes |
| color | White to slightly yellow |
| Water Solubility | SLIGHTLY SOLUBLE |
| BRN | 2614004 |
| InChI | InChI=1S/C9H10O3/c1-12-8-4-2-3-7(5-8)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| InChIKey | LEGPZHPSIPPYIO-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC(OC)=C1 |
| LogP | 1.500 |
| CAS DataBase Reference | 1798-09-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzeneacetic acid, 3-methoxy-(1798-09-0) |
Description and Uses
A fluorimetric method for the estimation of 4-hydroxy-3-methoxyphenylacetic acid (homovanillic acid) has been developed and applied to normal brain tissue. The presence of homovanillic acid in the caudate nucleus of normal animals of several species has been demonstrated.





