A5446912
2-Methoxy-6-pyridinecarboxaldehyde , 97% , 54221-96-4
Synonym(s):
2-Formyl-6-methoxypyridine;6-Methoxypyridine-2-carbaldehyde
| Pack Size | Price | Stock | Quantity |
| 1G | RMB71.20 | In Stock |
|
| 5G | RMB239.20 | In Stock |
|
| 25g | RMB1116.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 103-104 ºC (20 MMHG) |
| Density | 1.140 |
| refractive index | 1.532 |
| Flash point: | 81 ºC |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| pka | 2.44±0.10(Predicted) |
| color | Colorless to Light yellow |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C7H7NO2/c1-10-7-4-2-3-6(5-9)8-7/h2-5H,1H3 |
| InChIKey | YDNWTNODZDSPNZ-UHFFFAOYSA-N |
| SMILES | C1(C=O)=NC(OC)=CC=C1 |
| CAS DataBase Reference | 54221-96-4(CAS DataBase Reference) |
Description and Uses
Synthesis of the corresponding α-pyridoin via treatment with NaCN.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H334-H335 |
| Precautionary statements | P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-43 |
| Safety Statements | 26-36/37/39 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HS Code | 29333990 |
