A5454612
Mebhydrolin napadisylate , 98% , 6153-33-9
Synonym(s):
9-Benzyl-N-methyl-1,2,3,4-tetrahydro-α-carboline
CAS NO.：6153-33-9
Empirical Formula: C48H48N4O6S2
Molecular Weight: 841.05
MDL number: MFCD00083420
EINECS: 228-170-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB156.00 | In Stock |
|
| 5G | RMB456.00 | In Stock |
|
| 25G | RMB944.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 280°C (rough estimate) |
| Boiling point: | 409.28°C (rough estimate) |
| Density | 0.9799 (rough estimate) |
| refractive index | 1.8676 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) |
| form | Solid |
| color | White to Off-White |
| InChIKey | CJUOSBUQOWKEKJ-UHFFFAOYSA-N |
| SMILES | N1(CC2=CC=CC=C2)C2C=CC=CC=2C2CN(C)CCC1=2.N1(CC2C=CC=CC=2)C2C=CC=CC=2C2CN(C)CCC1=2.C12C=CC=C(S(=O)(=O)O)C1=CC=CC=2S(=O)(=O)O |
Description and Uses
Mebhydrolin (INN) is an antihistamine. Mebhydrolin is used for symptomatic relief of allergic symptoms caused by histamine release, including nasal allergies and allergic dermatosis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| WGK Germany | 3 |
| RTECS | QJ6845000 |
