A5458012
2-Methoxypyridine-4-carboxylic acid , 98% , 105596-63-2
Synonym(s):
2-Methoxyisonicotinic acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB52.00 | In Stock |
|
| 5G | RMB75.20 | In Stock |
|
| 25g | RMB219.20 | In Stock |
|
| 100g | RMB759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 198-200 °C |
| Boiling point: | 383.0±22.0 °C(Predicted) |
| Density | 1.284±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Solid or Crystalline Powder |
| pka | 4.50±0.10(Predicted) |
| color | White to pale brown |
| InChI | InChI=1S/C7H7NO3/c1-11-6-4-5(7(9)10)2-3-8-6/h2-4H,1H3,(H,9,10) |
| InChIKey | DPNDWFVORIGXQO-UHFFFAOYSA-N |
| SMILES | C1(OC)=NC=CC(C(O)=O)=C1 |
| CAS DataBase Reference | 105596-63-2(CAS DataBase Reference) |
Description and Uses
2-Methoxy-4-pyridinecarboxylic acid is often used as an intermediate in pharmaceutical chemistry and organic synthesis. In organic synthesis transformation, the carboxyl group on the pyridine ring can be converted into acyl chloride, ester group and amide under certain reaction conditions without being affected by the pyridine ring, and can also be reduced to a hydroxyl group.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |






