PRODUCT Properties
| Melting point: | 13-14 °C (lit.) |
| Boiling point: | 94-95 °C/21 mmHg (lit.) |
| Density | 1.268 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 180 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| Specific Gravity | 1.268 |
| color | Clear colorless to very pale yellow |
| BRN | 1963288 |
| InChI | InChI=1S/C9H7F3O2/c1-14-8(13)6-2-4-7(5-3-6)9(10,11)12/h2-5H,1H3 |
| InChIKey | VAZWXPJOOFSNLB-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(C(F)(F)F)C=C1 |
| CAS DataBase Reference | 2967-66-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-CF3-C6H4-COOCH3(2967-66-0) |
Description and Uses
Methyl 4-(trifluoromethyl)benzoate is an ester. The reduction of methyl (4-trifluoromethyl)benzoate catalyzed by MoO2Cl2 was reported.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





