A5476612
2-Methylpyrimidine-5-carboxylic acid , 97% , 5194-32-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB45.60 | In Stock |
|
| 1g | RMB105.60 | In Stock |
|
| 5G | RMB394.40 | In Stock |
|
| 25G | RMB1343.20 | In Stock |
|
| 100G | RMB4079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203-205°C |
| Boiling point: | 292.5±13.0 °C(Predicted) |
| Density | 1.319±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.91±0.10(Predicted) |
| form | Solid |
| Appearance | Yellow to orange Solid |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C6H6N2O2/c1-4-7-2-5(3-8-4)6(9)10/h2-3H,1H3,(H,9,10) |
| InChIKey | NMGIXZFBQPETOK-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=C(C(O)=O)C=N1 |
| CAS DataBase Reference | 5194-32-1(CAS DataBase Reference) |
Description and Uses
2-Methylpyrimidine-5-carboxylic Acid is used in perparation of substituted pyridazine- and pyridinecarboxamides as SCDs modulators.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36-36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 38220090 |







